C8H4BrClF4N2O2 — CID 59828232
5-bromo-6-(2-chloro-1,1,2,2-tetrafluoroethyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 59828232) has the molecular formula C8H4BrClF4N2O2 and a molecular weight of 351.48 g/mol. Its IUPAC name is 5-bromo-6-(2-chloro-1,1,2,2-tetrafluoroethyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 5-bromo-6-(2-chloro-1,1,2,2-tetrafluoroethyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59828232 |
| Molecular Formula | C8H4BrClF4N2O2 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | 5-bromo-6-(2-chloro-1,1,2,2-tetrafluoroethyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc(Br)c(C(F)(F)C(F)(F)Cl)[nH]c1=O |
| InChI | InChI=1S/C8H4BrClF4N2O2/c9-3-1-2(5(15)17)6(18)16-4(3)7(11,12)8(10,13)14/h1H,(H2,15,17)(H,16,18) |
| InChIKey | DCFJNMIJEGPDFM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|