C11H8F4N2O2 — CID 59828245
2-oxo-N-prop-2-ynyl-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridine-3-carboxamide (PubChem CID 59828245) has the molecular formula C11H8F4N2O2 and a molecular weight of 276.19 g/mol. Its IUPAC name is 2-oxo-N-prop-2-ynyl-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-prop-2-ynyl-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59828245 |
| Molecular Formula | C11H8F4N2O2 |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-oxo-N-prop-2-ynyl-6-(1,1,2,2-tetrafluoroethyl)-1H-pyridine-3-carboxamide |
| SMILES | C#CCNC(=O)c1ccc(C(F)(F)C(F)F)[nH]c1=O |
| InChI | InChI=1S/C11H8F4N2O2/c1-2-5-16-8(18)6-3-4-7(17-9(6)19)11(14,15)10(12)13/h1,3-4,10H,5H2,(H,16,18)(H,17,19) |
| InChIKey | QHZBYFHOXPOCSM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|