C12H13F5N2O2 — CID 59828247
N-butan-2-yl-2-oxo-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-3-carboxamide (PubChem CID 59828247) has the molecular formula C12H13F5N2O2 and a molecular weight of 312.24 g/mol. Its IUPAC name is N-butan-2-yl-2-oxo-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-butan-2-yl-2-oxo-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59828247 |
| Molecular Formula | C12H13F5N2O2 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-butan-2-yl-2-oxo-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyridine-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccc(C(F)(F)C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C12H13F5N2O2/c1-3-6(2)18-9(20)7-4-5-8(19-10(7)21)11(13,14)12(15,16)17/h4-6H,3H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | AYZYEPJXMAKBGS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|