C22H25N5O3 — CID 59829054
4-[7,8-diethoxy-4-methyl-3-(1,2,4-oxadiazol-3-yl)-4,5-dihydro-2,3-benzodiazepin-1-yl]aniline (PubChem CID 59829054) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[7,8-diethoxy-4-methyl-3-(1,2,4-oxadiazol-3-yl)-4,5-dihydro-2,3-benzodiazepin-1-yl]aniline.
| Compound Name | 4-[7,8-diethoxy-4-methyl-3-(1,2,4-oxadiazol-3-yl)-4,5-dihydro-2,3-benzodiazepin-1-yl]aniline |
|---|---|
| PubChem CID | 59829054 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-[7,8-diethoxy-4-methyl-3-(1,2,4-oxadiazol-3-yl)-4,5-dihydro-2,3-benzodiazepin-1-yl]aniline |
| SMILES | CCOc1cc2c(cc1OCC)C(c1ccc(N)cc1)=NN(c1ncon1)C(C)C2 |
| InChI | InChI=1S/C22H25N5O3/c1-4-28-19-11-16-10-14(3)27(22-24-13-30-26-22)25-21(15-6-8-17(23)9-7-15)18(16)12-20(19)29-5-2/h6-9,11-14H,4-5,10,23H2,1-3H3 |
| InChIKey | YKPZVDZZOBBIQO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|