C17H14F6N6O2S — CID 59829392
2-[2-(2-aminopyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 59829392) has the molecular formula C17H14F6N6O2S and a molecular weight of 480.39 g/mol. Its IUPAC name is 2-[2-(2-aminopyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2-aminopyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 59829392 |
| Molecular Formula | C17H14F6N6O2S |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2-[2-(2-aminopyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3sc(C(O)(C(F)(F)F)C(F)(F)F)cc3n2)cn1 |
| InChI | InChI=1S/C17H14F6N6O2S/c18-16(19,20)15(30,17(21,22)23)10-5-9-11(32-10)13(29-1-3-31-4-2-29)28-12(27-9)8-6-25-14(24)26-7-8/h5-7,30H,1-4H2,(H2,24,25,26) |
| InChIKey | CAIRAYAGJVFNJL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |