C38H44N4O3Si — CID 59829867
N-amino-N'-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-(3-trimethylsilylprop-2-ynyl)benzenecarboximidamide (PubChem CID 59829867) has the molecular formula C38H44N4O3Si and a molecular weight of 632.88 g/mol. Its IUPAC name is N-amino-N'-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-(3-trimethylsilylprop-2-ynyl)benzenecarboximidamide.
| Compound Name | N-amino-N'-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-(3-trimethylsilylprop-2-ynyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 59829867 |
| Molecular Formula | C38H44N4O3Si |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | N-amino-N'-[4-(morpholin-4-ylmethyl)phenyl]-2,4-bis(phenylmethoxy)-5-(3-trimethylsilylprop-2-ynyl)benzenecarboximidamide |
| SMILES | C[Si](C)(C)C#CCc1cc(/C(=N/c2ccc(CN3CCOCC3)cc2)NN)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C38H44N4O3Si/c1-46(2,3)24-10-15-33-25-35(38(41-39)40-34-18-16-30(17-19-34)27-42-20-22-43-23-21-42)37(45-29-32-13-8-5-9-14-32)26-36(33)44-28-31-11-6-4-7-12-31/h4-9,11-14,16-19,25-26H,15,20-23,27-29,39H2,1-3H3,(H,40,41) |
| InChIKey | VVOFZQUWOAOICC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|