About 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole
5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole (PubChem CID 59830038) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole |
| PubChem CID | 59830038 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole |
| SMILES | CC1=CC2=NN(C(C)C)NC2C=C1C |
| InChI | InChI=1S/C11H17N3/c1-7(2)14-12-10-5-8(3)9(4)6-11(10)13-14/h5-7,10,12H,1-4H3 |
| InChIKey | INWYTNYEWZWALC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole?
The IUPAC name of 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole (CID 59830038) is 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole.
What is the SMILES notation for 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole?
The canonical SMILES for 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole is CC1=CC2=NN(C(C)C)NC2C=C1C.
What is the InChIKey of 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole?
The InChIKey is INWYTNYEWZWALC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-7(2)14-12-10-5-8(3)9(4)6-11(10)13-14/h5-7,10,12H,1-4H3.
What are the key properties of 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole?
5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole has a molecular weight of 191.28 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2-propan-2-yl-1,7a-dihydrobenzotriazole is sourced from PubChem (CID 59830038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).