C25H26F6N6O2 — CID 59830539
propan-2-yl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2H-tetrazol-5-yl)amino]-2,6-dimethyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 59830539) has the molecular formula C25H26F6N6O2 and a molecular weight of 556.51 g/mol. Its IUPAC name is propan-2-yl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2H-tetrazol-5-yl)amino]-2,6-dimethyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | propan-2-yl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2H-tetrazol-5-yl)amino]-2,6-dimethyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 59830539 |
| Molecular Formula | C25H26F6N6O2 |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | propan-2-yl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2H-tetrazol-5-yl)amino]-2,6-dimethyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | Cc1ccc2c(c1)[C@@H](N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nn[nH]n1)C[C@@H](C)N2C(=O)OC(C)C |
| InChI | InChI=1S/C25H26F6N6O2/c1-13(2)39-23(38)37-15(4)8-21(19-7-14(3)5-6-20(19)37)36(22-32-34-35-33-22)12-16-9-17(24(26,27)28)11-18(10-16)25(29,30)31/h5-7,9-11,13,15,21H,8,12H2,1-4H3,(H,32,33,34,35)/t15-,21+/m1/s1 |
| InChIKey | KLFVMRURHIKTAG-VFNWGFHPSA-N |
| XLogP | 6.44 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |