C31H45NO17 — CID 598307
[4,5-diacetyloxy-6-(cyclopentylamino)-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 598307) has the molecular formula C31H45NO17 and a molecular weight of 703.69 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-(cyclopentylamino)-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-6-(cyclopentylamino)-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 598307 |
| Molecular Formula | C31H45NO17 |
| Molecular Weight | 703.69 g/mol |
| Exact Mass | 703.27 |
| IUPAC Name | [4,5-diacetyloxy-6-(cyclopentylamino)-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(NC2CCCC2)C(OC(C)=O)C(OC(C)=O)C1OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C31H45NO17/c1-14(33)40-12-22-25(26(43-17(4)36)28(45-19(6)38)30(47-22)32-21-10-8-9-11-21)49-31-29(46-20(7)39)27(44-18(5)37)24(42-16(3)35)23(48-31)13-41-15(2)34/h21-32H,8-13H2,1-7H3 |
| InChIKey | CJMVZTHXQKQWML-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 223.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.69 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|