C26H40N2O6 — CID 59830935
[(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(3-aminocyclobutyl)oxycarbonylcarbamate (PubChem CID 59830935) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(3-aminocyclobutyl)oxycarbonylcarbamate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(3-aminocyclobutyl)oxycarbonylcarbamate |
|---|---|
| PubChem CID | 59830935 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] N-(3-aminocyclobutyl)oxycarbonylcarbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)NC(=O)OC2CC(N)C2)[C@]2(C)C(C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C26H40N2O6/c1-6-24(4)13-19(34-23(32)28-22(31)33-17-11-16(27)12-17)25(5)14(2)7-9-26(15(3)21(24)30)10-8-18(29)20(25)26/h6,14-17,19-21,30H,1,7-13,27H2,2-5H3,(H,28,31,32)/t14?,15-,16?,17?,19+,20-,21-,24+,25-,26-/m0/s1 |
| InChIKey | CVJQOXPWNXAHEG-KMIORZBWSA-N |
| XLogP | 3.70 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|