About 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid
4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid (PubChem CID 59831052) has the molecular formula C14H10N2O2S2
and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid |
| PubChem CID | 59831052 |
| Molecular Formula | C14H10N2O2S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid |
| SMILES | Nc1cc2sc(-c3ccc(C(=O)O)cc3)nc2cc1S |
| InChI | InChI=1S/C14H10N2O2S2/c15-9-5-12-10(6-11(9)19)16-13(20-12)7-1-3-8(4-2-7)14(17)18/h1-6,19H,15H2,(H,17,18) |
| InChIKey | KASRJXJIMINERK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid?
The IUPAC name of 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid (CID 59831052) is 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid.
What is the SMILES notation for 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid?
The canonical SMILES for 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid is Nc1cc2sc(-c3ccc(C(=O)O)cc3)nc2cc1S.
What is the InChIKey of 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid?
The InChIKey is KASRJXJIMINERK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2S2/c15-9-5-12-10(6-11(9)19)16-13(20-12)7-1-3-8(4-2-7)14(17)18/h1-6,19H,15H2,(H,17,18).
What are the key properties of 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid?
4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid has a molecular weight of 302.38 g/mol, XLogP of 3.53, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-amino-5-sulfanyl-1,3-benzothiazol-2-yl)benzoic acid is sourced from PubChem (CID 59831052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).