About 2-methyl-7-methylidene-1,5-dithiocane
2-methyl-7-methylidene-1,5-dithiocane (PubChem CID 59831058) has the molecular formula C8H14S2
and a molecular weight of 174.33 g/mol. Its IUPAC name is 2-methyl-7-methylidene-1,5-dithiocane.
Molecular Properties
| Compound Name | 2-methyl-7-methylidene-1,5-dithiocane |
| PubChem CID | 59831058 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2-methyl-7-methylidene-1,5-dithiocane |
| SMILES | C=C1CSCCC(C)SC1 |
| InChI | InChI=1S/C8H14S2/c1-7-5-9-4-3-8(2)10-6-7/h8H,1,3-6H2,2H3 |
| InChIKey | MXKCBUFITHGGMJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-7-methylidene-1,5-dithiocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-methylidene-1,5-dithiocane?
The IUPAC name of 2-methyl-7-methylidene-1,5-dithiocane (CID 59831058) is 2-methyl-7-methylidene-1,5-dithiocane.
What is the SMILES notation for 2-methyl-7-methylidene-1,5-dithiocane?
The canonical SMILES for 2-methyl-7-methylidene-1,5-dithiocane is C=C1CSCCC(C)SC1.
What is the InChIKey of 2-methyl-7-methylidene-1,5-dithiocane?
The InChIKey is MXKCBUFITHGGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S2/c1-7-5-9-4-3-8(2)10-6-7/h8H,1,3-6H2,2H3.
What are the key properties of 2-methyl-7-methylidene-1,5-dithiocane?
2-methyl-7-methylidene-1,5-dithiocane has a molecular weight of 174.33 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-methylidene-1,5-dithiocane is sourced from PubChem (CID 59831058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).