C18H10F2N2O2+2 — CID 59831184
8',10'-difluorospiro[[1,3]oxazolo[3,4-a]pyridin-4-ium-3,6'-pyrido[2,1-a]isoindol-5-ium]-1-one (PubChem CID 59831184) has the molecular formula C18H10F2N2O2+2 and a molecular weight of 324.29 g/mol. Its IUPAC name is 8',10'-difluorospiro[[1,3]oxazolo[3,4-a]pyridin-4-ium-3,6'-pyrido[2,1-a]isoindol-5-ium]-1-one.
| Compound Name | 8',10'-difluorospiro[[1,3]oxazolo[3,4-a]pyridin-4-ium-3,6'-pyrido[2,1-a]isoindol-5-ium]-1-one |
|---|---|
| PubChem CID | 59831184 |
| Molecular Formula | C18H10F2N2O2+2 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 8',10'-difluorospiro[[1,3]oxazolo[3,4-a]pyridin-4-ium-3,6'-pyrido[2,1-a]isoindol-5-ium]-1-one |
| SMILES | O=C1OC2(c3cc(F)cc(F)c3-c3cccc[n+]32)[n+]2ccccc21 |
| InChI | InChI=1S/C18H10F2N2O2/c19-11-9-12-16(13(20)10-11)14-5-1-3-7-21(14)18(12)22-8-4-2-6-15(22)17(23)24-18/h1-10H/q+2 |
| InChIKey | OTZIWSWKFRBOFG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|