C24H29NO — CID 59832089
1,8-diethyl-6-phenyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indole (PubChem CID 59832089) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is 1,8-diethyl-6-phenyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indole.
| Compound Name | 1,8-diethyl-6-phenyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indole |
|---|---|
| PubChem CID | 59832089 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 1,8-diethyl-6-phenyl-1-propyl-4,9-dihydro-3H-pyrano[3,4-b]indole |
| SMILES | CCCC1(CC)OCCc2c1[nH]c1c(CC)cc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C24H29NO/c1-4-13-24(6-3)23-20(12-14-26-24)21-16-19(18-10-8-7-9-11-18)15-17(5-2)22(21)25-23/h7-11,15-16,25H,4-6,12-14H2,1-3H3 |
| InChIKey | ZMCCBOFMAAWUJS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |