C26H38O3 — CID 59832147
(2S,3S)-2-[(1E,3Z,5R,7E,9E,11R)-3-ethyl-5,9,11,13-tetramethyl-12-oxotetradeca-1,3,7,9-tetraenyl]-3-methyl-2,3-dihydropyran-6-one (PubChem CID 59832147) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (2S,3S)-2-[(1E,3Z,5R,7E,9E,11R)-3-ethyl-5,9,11,13-tetramethyl-12-oxotetradeca-1,3,7,9-tetraenyl]-3-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(1E,3Z,5R,7E,9E,11R)-3-ethyl-5,9,11,13-tetramethyl-12-oxotetradeca-1,3,7,9-tetraenyl]-3-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 59832147 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (2S,3S)-2-[(1E,3Z,5R,7E,9E,11R)-3-ethyl-5,9,11,13-tetramethyl-12-oxotetradeca-1,3,7,9-tetraenyl]-3-methyl-2,3-dihydropyran-6-one |
| SMILES | CCC(=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)C(=O)C(C)C)/C=C/[C@@H]1OC(=O)C=C[C@@H]1C |
| InChI | InChI=1S/C26H38O3/c1-8-23(13-14-24-21(6)12-15-25(27)29-24)17-20(5)11-9-10-19(4)16-22(7)26(28)18(2)3/h9-10,12-18,20-22,24H,8,11H2,1-7H3/b10-9+,14-13+,19-16+,23-17-/t20-,21+,22-,24+/m1/s1 |
| InChIKey | LGOOOGNCGSKPAX-MUGKRTLASA-N |
| XLogP | 6.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|