About 1,6-dimethyl-2,3-dihydroindole
1,6-dimethyl-2,3-dihydroindole (PubChem CID 59833304) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 1,6-dimethyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1,6-dimethyl-2,3-dihydroindole |
| PubChem CID | 59833304 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 1,6-dimethyl-2,3-dihydroindole |
| SMILES | Cc1ccc2c(c1)N(C)CC2 |
| InChI | InChI=1S/C10H13N/c1-8-3-4-9-5-6-11(2)10(9)7-8/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | QXSSYMHCIFVEMD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-dimethyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-2,3-dihydroindole?
The IUPAC name of 1,6-dimethyl-2,3-dihydroindole (CID 59833304) is 1,6-dimethyl-2,3-dihydroindole.
What is the SMILES notation for 1,6-dimethyl-2,3-dihydroindole?
The canonical SMILES for 1,6-dimethyl-2,3-dihydroindole is Cc1ccc2c(c1)N(C)CC2.
What is the InChIKey of 1,6-dimethyl-2,3-dihydroindole?
The InChIKey is QXSSYMHCIFVEMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-8-3-4-9-5-6-11(2)10(9)7-8/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 1,6-dimethyl-2,3-dihydroindole?
1,6-dimethyl-2,3-dihydroindole has a molecular weight of 147.22 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-2,3-dihydroindole is sourced from PubChem (CID 59833304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).