About 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene
8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene (PubChem CID 59834052) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene.
Analyze 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The IUPAC name of 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene (CID 59834052) is 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene.
What is the SMILES notation for 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The canonical SMILES for 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene is Cn1n2c3ccccc3n12.
What is the InChIKey of 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The InChIKey is QAVGLYKUBXPJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-8-9-6-4-2-3-5-7(6)10(8)9/h2-5H,1H3.
What are the key properties of 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene has a molecular weight of 133.15 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-7,8,9-triazatricyclo[4.3.0.07,9]nona-1,3,5-triene is sourced from PubChem (CID 59834052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).