About (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten
(2R,5S)-2-ethyl-5-methanidyloxolane;tungsten (PubChem CID 59834110) has the molecular formula C7H13OW-
and a molecular weight of 297.02 g/mol. Its IUPAC name is (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten.
Molecular Properties
| Compound Name | (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten |
| PubChem CID | 59834110 |
| Molecular Formula | C7H13OW- |
| Molecular Weight | 297.02 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten |
| SMILES | [CH2-][C@H]1CC[C@@H](CC)O1.[W] |
| InChI | InChI=1S/C7H13O.W/c1-3-7-5-4-6(2)8-7;/h6-7H,2-5H2,1H3;/q-1;/t6-,7+;/m0./s1 |
| InChIKey | MHPHKPJHBKTMJE-UOERWJHTSA-N |
| XLogP | 1.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.02 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten?
The IUPAC name of (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten (CID 59834110) is (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten.
What is the SMILES notation for (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten?
The canonical SMILES for (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten is [CH2-][C@H]1CC[C@@H](CC)O1.[W].
What is the InChIKey of (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten?
The InChIKey is MHPHKPJHBKTMJE-UOERWJHTSA-N. The full InChI is InChI=1S/C7H13O.W/c1-3-7-5-4-6(2)8-7;/h6-7H,2-5H2,1H3;/q-1;/t6-,7+;/m0./s1.
What are the key properties of (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten?
(2R,5S)-2-ethyl-5-methanidyloxolane;tungsten has a molecular weight of 297.02 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2-ethyl-5-methanidyloxolane;tungsten is sourced from PubChem (CID 59834110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).