About N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide
N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide (PubChem CID 59834294) has the molecular formula C14H12F2N2O2
and a molecular weight of 278.26 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide |
| PubChem CID | 59834294 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(Oc2ccc(F)cc2F)ncc1C |
| InChI | InChI=1S/C14H12F2N2O2/c1-8-7-17-14(6-12(8)18-9(2)19)20-13-4-3-10(15)5-11(13)16/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | ATIHVVXJRRMMTL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide?
The IUPAC name of N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide (CID 59834294) is N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide.
What is the SMILES notation for N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide?
The canonical SMILES for N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide is CC(=O)Nc1cc(Oc2ccc(F)cc2F)ncc1C.
What is the InChIKey of N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide?
The InChIKey is ATIHVVXJRRMMTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2O2/c1-8-7-17-14(6-12(8)18-9(2)19)20-13-4-3-10(15)5-11(13)16/h3-7H,1-2H3,(H,17,18,19).
What are the key properties of N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide?
N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide has a molecular weight of 278.26 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-difluorophenoxy)-5-methyl-4-pyridinyl]acetamide is sourced from PubChem (CID 59834294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).