About 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate
2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate (PubChem CID 59834451) has the molecular formula C18H20Cl2N2O4
and a molecular weight of 399.27 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate |
| PubChem CID | 59834451 |
| Molecular Formula | C18H20Cl2N2O4 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate |
| SMILES | CC(=O)OCCc1cc(Cl)c(Oc2cc(C(C)C)c(=O)n(C)n2)c(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N2O4/c1-10(2)13-9-16(21-22(4)18(13)24)26-17-14(19)7-12(8-15(17)20)5-6-25-11(3)23/h7-10H,5-6H2,1-4H3 |
| InChIKey | LOAYQQBGCHHMAK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate?
The IUPAC name of 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate (CID 59834451) is 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate.
What is the SMILES notation for 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate?
The canonical SMILES for 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate is CC(=O)OCCc1cc(Cl)c(Oc2cc(C(C)C)c(=O)n(C)n2)c(Cl)c1.
What is the InChIKey of 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate?
The InChIKey is LOAYQQBGCHHMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2N2O4/c1-10(2)13-9-16(21-22(4)18(13)24)26-17-14(19)7-12(8-15(17)20)5-6-25-11(3)23/h7-10H,5-6H2,1-4H3.
What are the key properties of 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate?
2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate has a molecular weight of 399.27 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dichloro-4-(1-methyl-6-oxo-5-propan-2-ylpyridazin-3-yl)oxyphenyl]ethyl acetate is sourced from PubChem (CID 59834451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).