About 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol
3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol (PubChem CID 59834510) has the molecular formula C16H17Br2ClN2O2
and a molecular weight of 464.59 g/mol. Its IUPAC name is 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol |
| PubChem CID | 59834510 |
| Molecular Formula | C16H17Br2ClN2O2 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 461.93 |
| IUPAC Name | 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol |
| SMILES | CC(C)c1cc(Oc2c(Br)cc(CCCO)cc2Br)nnc1Cl |
| InChI | InChI=1S/C16H17Br2ClN2O2/c1-9(2)11-8-14(20-21-16(11)19)23-15-12(17)6-10(4-3-5-22)7-13(15)18/h6-9,22H,3-5H2,1-2H3 |
| InChIKey | OGEKBXXDAFYZNN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol?
The IUPAC name of 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol (CID 59834510) is 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol.
What is the SMILES notation for 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol?
The canonical SMILES for 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol is CC(C)c1cc(Oc2c(Br)cc(CCCO)cc2Br)nnc1Cl.
What is the InChIKey of 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol?
The InChIKey is OGEKBXXDAFYZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Br2ClN2O2/c1-9(2)11-8-14(20-21-16(11)19)23-15-12(17)6-10(4-3-5-22)7-13(15)18/h6-9,22H,3-5H2,1-2H3.
What are the key properties of 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol?
3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol has a molecular weight of 464.59 g/mol, XLogP of 5.50, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dibromo-4-(6-chloro-5-propan-2-ylpyridazin-3-yl)oxyphenyl]propan-1-ol is sourced from PubChem (CID 59834510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).