About 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate
2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate (PubChem CID 59834524) has the molecular formula C17H18Cl2N2O4
and a molecular weight of 385.25 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate |
| PubChem CID | 59834524 |
| Molecular Formula | C17H18Cl2N2O4 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate |
| SMILES | CC(=O)OCCc1cc(Cl)c(Oc2cc(C(C)C)c(=O)[nH]n2)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O4/c1-9(2)12-8-15(20-21-17(12)23)25-16-13(18)6-11(7-14(16)19)4-5-24-10(3)22/h6-9H,4-5H2,1-3H3,(H,21,23) |
| InChIKey | NOPYPMYDWWEEQA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate?
The IUPAC name of 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate (CID 59834524) is 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate.
What is the SMILES notation for 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate?
The canonical SMILES for 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate is CC(=O)OCCc1cc(Cl)c(Oc2cc(C(C)C)c(=O)[nH]n2)c(Cl)c1.
What is the InChIKey of 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate?
The InChIKey is NOPYPMYDWWEEQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O4/c1-9(2)12-8-15(20-21-17(12)23)25-16-13(18)6-11(7-14(16)19)4-5-24-10(3)22/h6-9H,4-5H2,1-3H3,(H,21,23).
What are the key properties of 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate?
2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate has a molecular weight of 385.25 g/mol, XLogP of 4.10, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]ethyl acetate is sourced from PubChem (CID 59834524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).