About 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine
6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine (PubChem CID 59834541) has the molecular formula C15H14BrCl3N2S
and a molecular weight of 440.62 g/mol. Its IUPAC name is 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine.
Molecular Properties
| Compound Name | 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine |
| PubChem CID | 59834541 |
| Molecular Formula | C15H14BrCl3N2S |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 437.91 |
| IUPAC Name | 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine |
| SMILES | CC(C)c1cc(Sc2c(Cl)cc(CCBr)cc2Cl)nnc1Cl |
| InChI | InChI=1S/C15H14BrCl3N2S/c1-8(2)10-7-13(20-21-15(10)19)22-14-11(17)5-9(3-4-16)6-12(14)18/h5-8H,3-4H2,1-2H3 |
| InChIKey | MLVRECRMWNFIBD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine?
The IUPAC name of 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine (CID 59834541) is 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine.
What is the SMILES notation for 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine?
The canonical SMILES for 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine is CC(C)c1cc(Sc2c(Cl)cc(CCBr)cc2Cl)nnc1Cl.
What is the InChIKey of 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine?
The InChIKey is MLVRECRMWNFIBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrCl3N2S/c1-8(2)10-7-13(20-21-15(10)19)22-14-11(17)5-9(3-4-16)6-12(14)18/h5-8H,3-4H2,1-2H3.
What are the key properties of 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine?
6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine has a molecular weight of 440.62 g/mol, XLogP of 6.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-chloro-4-propan-2-ylpyridazine is sourced from PubChem (CID 59834541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).