About 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine
3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine (PubChem CID 59834550) has the molecular formula C15H13Cl3N6S
and a molecular weight of 415.74 g/mol. Its IUPAC name is 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine.
Molecular Properties
| Compound Name | 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine |
| PubChem CID | 59834550 |
| Molecular Formula | C15H13Cl3N6S |
| Molecular Weight | 415.74 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine |
| SMILES | CC(C)c1cc(Sc2c(Cl)cc(Cc3nn[nH]n3)cc2Cl)nnc1Cl |
| InChI | InChI=1S/C15H13Cl3N6S/c1-7(2)9-6-13(21-22-15(9)18)25-14-10(16)3-8(4-11(14)17)5-12-19-23-24-20-12/h3-4,6-7H,5H2,1-2H3,(H,19,20,23,24) |
| InChIKey | XUXTVZMTAHEBRM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine?
The IUPAC name of 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine (CID 59834550) is 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine.
What is the SMILES notation for 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine?
The canonical SMILES for 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine is CC(C)c1cc(Sc2c(Cl)cc(Cc3nn[nH]n3)cc2Cl)nnc1Cl.
What is the InChIKey of 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine?
The InChIKey is XUXTVZMTAHEBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl3N6S/c1-7(2)9-6-13(21-22-15(9)18)25-14-10(16)3-8(4-11(14)17)5-12-19-23-24-20-12/h3-4,6-7H,5H2,1-2H3,(H,19,20,23,24).
What are the key properties of 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine?
3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine has a molecular weight of 415.74 g/mol, XLogP of 4.82, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-[2,6-dichloro-4-(2H-tetrazol-5-ylmethyl)phenyl]sulfanyl-4-propan-2-ylpyridazine is sourced from PubChem (CID 59834550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).