C25H42FNO4Si — CID 59834866
tert-butyl N-[(1S,3S,4S)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethoxy]-3-fluorocyclohexyl]carbamate (PubChem CID 59834866) has the molecular formula C25H42FNO4Si and a molecular weight of 467.70 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S,4S)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethoxy]-3-fluorocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S,4S)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethoxy]-3-fluorocyclohexyl]carbamate |
|---|---|
| PubChem CID | 59834866 |
| Molecular Formula | C25H42FNO4Si |
| Molecular Weight | 467.70 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | tert-butyl N-[(1S,3S,4S)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethoxy]-3-fluorocyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](OCC(O[Si](C)(C)C(C)(C)C)c2ccccc2)[C@@H](F)C1 |
| InChI | InChI=1S/C25H42FNO4Si/c1-24(2,3)30-23(28)27-19-14-15-21(20(26)16-19)29-17-22(18-12-10-9-11-13-18)31-32(7,8)25(4,5)6/h9-13,19-22H,14-17H2,1-8H3,(H,27,28)/t19-,20-,21-,22?/m0/s1 |
| InChIKey | IZQXWUUJXPPRFY-RQLHVLPXSA-N |
| XLogP | 6.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.70 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|