C19H26FNO4 — CID 59834872
tert-butyl N-[(1S,3S,4S)-3-fluoro-4-phenacyloxycyclohexyl]carbamate (PubChem CID 59834872) has the molecular formula C19H26FNO4 and a molecular weight of 351.42 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S,4S)-3-fluoro-4-phenacyloxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S,4S)-3-fluoro-4-phenacyloxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 59834872 |
| Molecular Formula | C19H26FNO4 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | tert-butyl N-[(1S,3S,4S)-3-fluoro-4-phenacyloxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](OCC(=O)c2ccccc2)[C@@H](F)C1 |
| InChI | InChI=1S/C19H26FNO4/c1-19(2,3)25-18(23)21-14-9-10-17(15(20)11-14)24-12-16(22)13-7-5-4-6-8-13/h4-8,14-15,17H,9-12H2,1-3H3,(H,21,23)/t14-,15-,17-/m0/s1 |
| InChIKey | ZZOZHIOKVOWFKO-ZOBUZTSGSA-N |
| XLogP | 3.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |