C21H35FO5SSi — CID 59834924
[(1R,3S,4S)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethoxy]-3-fluorocyclohexyl] methanesulfonate (PubChem CID 59834924) has the molecular formula C21H35FO5SSi and a molecular weight of 446.66 g/mol. Its IUPAC name is [(1R,3S,4S)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethoxy]-3-fluorocyclohexyl] methanesulfonate.
| Compound Name | [(1R,3S,4S)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethoxy]-3-fluorocyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 59834924 |
| Molecular Formula | C21H35FO5SSi |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [(1R,3S,4S)-4-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethoxy]-3-fluorocyclohexyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC(CO[C@H]1CC[C@@H](OS(C)(=O)=O)C[C@@H]1F)c1ccccc1 |
| InChI | InChI=1S/C21H35FO5SSi/c1-21(2,3)29(5,6)27-20(16-10-8-7-9-11-16)15-25-19-13-12-17(14-18(19)22)26-28(4,23)24/h7-11,17-20H,12-15H2,1-6H3/t17-,18+,19+,20?/m1/s1 |
| InChIKey | COYTUXWXNRREIX-QYRWZOIFSA-N |
| XLogP | 5.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|