C23H21ClN6O2S — CID 59835151
4-N-[3-chloro-4-(1,3-thiazol-2-ylmethoxy)phenyl]-6-N-[(4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-oxazol-2-yl]quinazoline-4,6-diamine (PubChem CID 59835151) has the molecular formula C23H21ClN6O2S and a molecular weight of 480.98 g/mol. Its IUPAC name is 4-N-[3-chloro-4-(1,3-thiazol-2-ylmethoxy)phenyl]-6-N-[(4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-oxazol-2-yl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[3-chloro-4-(1,3-thiazol-2-ylmethoxy)phenyl]-6-N-[(4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-oxazol-2-yl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 59835151 |
| Molecular Formula | C23H21ClN6O2S |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 4-N-[3-chloro-4-(1,3-thiazol-2-ylmethoxy)phenyl]-6-N-[(4R,5S)-4,5-dimethyl-4,5-dihydro-1,3-oxazol-2-yl]quinazoline-4,6-diamine |
| SMILES | C[C@@H]1OC(Nc2ccc3ncnc(Nc4ccc(OCc5nccs5)c(Cl)c4)c3c2)=N[C@@H]1C |
| InChI | InChI=1S/C23H21ClN6O2S/c1-13-14(2)32-23(28-13)30-15-3-5-19-17(9-15)22(27-12-26-19)29-16-4-6-20(18(24)10-16)31-11-21-25-7-8-33-21/h3-10,12-14H,11H2,1-2H3,(H,28,30)(H,26,27,29)/t13-,14+/m1/s1 |
| InChIKey | WJAYOTNQKHCQDP-KGLIPLIRSA-N |
| XLogP | 5.64 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |