C7H8N6O2 — CID 59835279
8-[(Z)-methoxyiminomethyl]-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one (PubChem CID 59835279) has the molecular formula C7H8N6O2 and a molecular weight of 208.18 g/mol. Its IUPAC name is 8-[(Z)-methoxyiminomethyl]-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one.
| Compound Name | 8-[(Z)-methoxyiminomethyl]-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one |
|---|---|
| PubChem CID | 59835279 |
| Molecular Formula | C7H8N6O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 8-[(Z)-methoxyiminomethyl]-3-methylimidazo[5,1-d][1,2,3,5]tetrazin-4-one |
| SMILES | CO/N=C\c1ncn2c(=O)n(C)nnc12 |
| InChI | InChI=1S/C7H8N6O2/c1-12-7(14)13-4-8-5(3-9-15-2)6(13)10-11-12/h3-4H,1-2H3/b9-3- |
| InChIKey | NGOJCIZWCJJDDH-OQFOIZHKSA-N |
| XLogP | -1.20 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|