C28H31NO9 — CID 59835410
(7S,9S)-9-acetyl-7-[(2S,4S,5S,6S)-4-amino-5,6-dimethyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 59835410) has the molecular formula C28H31NO9 and a molecular weight of 525.55 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-7-[(2S,4S,5S,6S)-4-amino-5,6-dimethyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-7-[(2S,4S,5S,6S)-4-amino-5,6-dimethyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 59835410 |
| Molecular Formula | C28H31NO9 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | (7S,9S)-9-acetyl-7-[(2S,4S,5S,6S)-4-amino-5,6-dimethyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3O[C@H]1C[C@H](N)[C@H](C)[C@H](C)O1 |
| InChI | InChI=1S/C28H31NO9/c1-11-12(2)37-19(8-16(11)29)38-18-10-28(35,13(3)30)9-15-21(18)27(34)23-22(25(15)32)24(31)14-6-5-7-17(36-4)20(14)26(23)33/h5-7,11-12,16,18-19,32,34-35H,8-10,29H2,1-4H3/t11-,12+,16+,18+,19+,28+/m1/s1 |
| InChIKey | ZIVPFHZCRNQJDH-SOSCJKDHSA-N |
| XLogP | 2.30 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|