About 2-thiatricyclo[3.3.1.13,7]decan-4-ol
2-thiatricyclo[3.3.1.13,7]decan-4-ol (PubChem CID 598357) has the molecular formula C9H14OS
and a molecular weight of 170.28 g/mol. Its IUPAC name is 2-thiatricyclo[3.3.1.13,7]decan-4-ol.
Molecular Properties
| Compound Name | 2-thiatricyclo[3.3.1.13,7]decan-4-ol |
| PubChem CID | 598357 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-thiatricyclo[3.3.1.13,7]decan-4-ol |
| SMILES | OC1C2CC3CC(C2)SC1C3 |
| InChI | InChI=1S/C9H14OS/c10-9-6-1-5-2-7(4-6)11-8(9)3-5/h5-10H,1-4H2 |
| InChIKey | QYWXGQGTCFPNAY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-thiatricyclo[3.3.1.13,7]decan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiatricyclo[3.3.1.13,7]decan-4-ol?
The IUPAC name of 2-thiatricyclo[3.3.1.13,7]decan-4-ol (CID 598357) is 2-thiatricyclo[3.3.1.13,7]decan-4-ol.
What is the SMILES notation for 2-thiatricyclo[3.3.1.13,7]decan-4-ol?
The canonical SMILES for 2-thiatricyclo[3.3.1.13,7]decan-4-ol is OC1C2CC3CC(C2)SC1C3.
What is the InChIKey of 2-thiatricyclo[3.3.1.13,7]decan-4-ol?
The InChIKey is QYWXGQGTCFPNAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14OS/c10-9-6-1-5-2-7(4-6)11-8(9)3-5/h5-10H,1-4H2.
What are the key properties of 2-thiatricyclo[3.3.1.13,7]decan-4-ol?
2-thiatricyclo[3.3.1.13,7]decan-4-ol has a molecular weight of 170.28 g/mol, XLogP of 1.65, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiatricyclo[3.3.1.13,7]decan-4-ol is sourced from PubChem (CID 598357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).