C9H17N2- — CID 59835771
2-methanidyl-7-methyl-2,7-diazaspiro[4.4]nonane (PubChem CID 59835771) has the molecular formula C9H17N2- and a molecular weight of 153.25 g/mol. Its IUPAC name is 2-methanidyl-7-methyl-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-methanidyl-7-methyl-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 59835771 |
| Molecular Formula | C9H17N2- |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | 2-methanidyl-7-methyl-2,7-diazaspiro[4.4]nonane |
| SMILES | [CH2-]N1CCC2(CCN(C)C2)C1 |
| InChI | InChI=1S/C9H17N2/c1-10-5-3-9(7-10)4-6-11(2)8-9/h1,3-8H2,2H3/q-1 |
| InChIKey | RWMXZMJCNUFZFN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|