C32H36FN3O3 — CID 59836201
ethyl (2S,3R)-3-[[1-(4-fluorophenyl)-7-(2-phenylethyl)-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59836201) has the molecular formula C32H36FN3O3 and a molecular weight of 529.66 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[[1-(4-fluorophenyl)-7-(2-phenylethyl)-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-[[1-(4-fluorophenyl)-7-(2-phenylethyl)-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59836201 |
| Molecular Formula | C32H36FN3O3 |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | ethyl (2S,3R)-3-[[1-(4-fluorophenyl)-7-(2-phenylethyl)-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2CCC(C2)[C@H]1NC(=O)c1nn(-c2ccc(F)cc2)c2c1CCCC2CCc1ccccc1 |
| InChI | InChI=1S/C32H36FN3O3/c1-2-39-32(38)27-22-13-14-23(19-22)28(27)34-31(37)29-26-10-6-9-21(12-11-20-7-4-3-5-8-20)30(26)36(35-29)25-17-15-24(33)16-18-25/h3-5,7-8,15-18,21-23,27-28H,2,6,9-14,19H2,1H3,(H,34,37)/t21?,22?,23?,27-,28+/m0/s1 |
| InChIKey | ADXFXLCURGGHKK-FJXIBAFOSA-N |
| XLogP | 5.77 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |