C28H37N3O3 — CID 59836258
ethyl 1-benzyl-3-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-4,5,6,7-tetrahydroindazole-5-carboxylate (PubChem CID 59836258) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is ethyl 1-benzyl-3-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-4,5,6,7-tetrahydroindazole-5-carboxylate.
| Compound Name | ethyl 1-benzyl-3-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-4,5,6,7-tetrahydroindazole-5-carboxylate |
|---|---|
| PubChem CID | 59836258 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | ethyl 1-benzyl-3-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-4,5,6,7-tetrahydroindazole-5-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(c(C(=O)NC3C4(C)CCC(C4)C3(C)C)nn2Cc2ccccc2)C1 |
| InChI | InChI=1S/C28H37N3O3/c1-5-34-25(33)19-11-12-22-21(15-19)23(30-31(22)17-18-9-7-6-8-10-18)24(32)29-26-27(2,3)20-13-14-28(26,4)16-20/h6-10,19-20,26H,5,11-17H2,1-4H3,(H,29,32) |
| InChIKey | HJZVXGYENGDSMH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |