C30H32FN3O3 — CID 59836417
ethyl (2S,3R)-3-[[1-(4-fluorophenyl)-7-phenyl-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59836417) has the molecular formula C30H32FN3O3 and a molecular weight of 501.60 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[[1-(4-fluorophenyl)-7-phenyl-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-[[1-(4-fluorophenyl)-7-phenyl-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59836417 |
| Molecular Formula | C30H32FN3O3 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | ethyl (2S,3R)-3-[[1-(4-fluorophenyl)-7-phenyl-4,5,6,7-tetrahydroindazole-3-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2CCC(C2)[C@H]1NC(=O)c1nn(-c2ccc(F)cc2)c2c1CCCC2c1ccccc1 |
| InChI | InChI=1S/C30H32FN3O3/c1-2-37-30(36)25-19-11-12-20(17-19)26(25)32-29(35)27-24-10-6-9-23(18-7-4-3-5-8-18)28(24)34(33-27)22-15-13-21(31)14-16-22/h3-5,7-8,13-16,19-20,23,25-26H,2,6,9-12,17H2,1H3,(H,32,35)/t19?,20?,23?,25-,26+/m0/s1 |
| InChIKey | QHCAQZYSHIKLBA-LGWMAXLESA-N |
| XLogP | 5.19 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |