C16H25NO — CID 59836578
N-[3-(2,2-dimethylpropyl)phenyl]-N,2-dimethylpropanamide (PubChem CID 59836578) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is N-[3-(2,2-dimethylpropyl)phenyl]-N,2-dimethylpropanamide.
| Compound Name | N-[3-(2,2-dimethylpropyl)phenyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 59836578 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-[3-(2,2-dimethylpropyl)phenyl]-N,2-dimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)c1cccc(CC(C)(C)C)c1 |
| InChI | InChI=1S/C16H25NO/c1-12(2)15(18)17(6)14-9-7-8-13(10-14)11-16(3,4)5/h7-10,12H,11H2,1-6H3 |
| InChIKey | DCDFRUHJVVWHES-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |