C23H38N2O2 — CID 59837509
1-[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]oxan-4-yl]-N,N-dimethylmethanamine (PubChem CID 59837509) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]oxan-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]oxan-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 59837509 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | 1-[4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]oxan-4-yl]-N,N-dimethylmethanamine |
| SMILES | C[C@@H]1CC[C@@H](C)N1CCCOc1ccc(C2(CN(C)C)CCOCC2)cc1 |
| InChI | InChI=1S/C23H38N2O2/c1-19-6-7-20(2)25(19)14-5-15-27-22-10-8-21(9-11-22)23(18-24(3)4)12-16-26-17-13-23/h8-11,19-20H,5-7,12-18H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | UPHRKBXEQZNQTE-WOJBJXKFSA-N |
| XLogP | 3.94 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|