C27H31N5O — CID 59837796
N-[3-(diethylaminomethoxy)phenyl]-7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-amine (PubChem CID 59837796) has the molecular formula C27H31N5O and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[3-(diethylaminomethoxy)phenyl]-7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-amine.
| Compound Name | N-[3-(diethylaminomethoxy)phenyl]-7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 59837796 |
| Molecular Formula | C27H31N5O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | N-[3-(diethylaminomethoxy)phenyl]-7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-amine |
| SMILES | CCN(CC)COc1cccc(Nc2nnc3cc(-c4c(C)cccc4C)cc(C)c3n2)c1 |
| InChI | InChI=1S/C27H31N5O/c1-6-32(7-2)17-33-23-13-9-12-22(16-23)28-27-29-26-20(5)14-21(15-24(26)30-31-27)25-18(3)10-8-11-19(25)4/h8-16H,6-7,17H2,1-5H3,(H,28,29,31) |
| InChIKey | OATMOMPSJGICMV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|