C21H18ClN5 — CID 59837802
N-(6-chloro-3-pyridinyl)-7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-amine (PubChem CID 59837802) has the molecular formula C21H18ClN5 and a molecular weight of 375.86 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 59837802 |
| Molecular Formula | C21H18ClN5 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-7-(2,6-dimethylphenyl)-5-methyl-1,2,4-benzotriazin-3-amine |
| SMILES | Cc1cccc(C)c1-c1cc(C)c2nc(Nc3ccc(Cl)nc3)nnc2c1 |
| InChI | InChI=1S/C21H18ClN5/c1-12-5-4-6-13(2)19(12)15-9-14(3)20-17(10-15)26-27-21(25-20)24-16-7-8-18(22)23-11-16/h4-11H,1-3H3,(H,24,25,27) |
| InChIKey | LCMRETZSELKBIP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|