About 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine
6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine (PubChem CID 59837820) has the molecular formula C4H5BrN4O2
and a molecular weight of 221.01 g/mol. Its IUPAC name is 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine.
Molecular Properties
| Compound Name | 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine |
| PubChem CID | 59837820 |
| Molecular Formula | C4H5BrN4O2 |
| Molecular Weight | 221.01 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine |
| SMILES | COc1nc(N)n[n+]([O-])c1Br |
| InChI | InChI=1S/C4H5BrN4O2/c1-11-3-2(5)9(10)8-4(6)7-3/h1H3,(H2,6,7,8) |
| InChIKey | JKORSWSAUSLUOI-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.01 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine?
The IUPAC name of 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine (CID 59837820) is 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine.
What is the SMILES notation for 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine?
The canonical SMILES for 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine is COc1nc(N)n[n+]([O-])c1Br.
What is the InChIKey of 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine?
The InChIKey is JKORSWSAUSLUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrN4O2/c1-11-3-2(5)9(10)8-4(6)7-3/h1H3,(H2,6,7,8).
What are the key properties of 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine?
6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine has a molecular weight of 221.01 g/mol, XLogP of -0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-methoxy-1-oxido-1,2,4-triazin-1-ium-3-amine is sourced from PubChem (CID 59837820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).