C18H24N+ — CID 59838099
1-[2-(3,4-dimethylphenyl)ethyl]-2,4,6-trimethylpyridin-1-ium (PubChem CID 59838099) has the molecular formula C18H24N+ and a molecular weight of 254.40 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenyl)ethyl]-2,4,6-trimethylpyridin-1-ium.
| Compound Name | 1-[2-(3,4-dimethylphenyl)ethyl]-2,4,6-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 59838099 |
| Molecular Formula | C18H24N+ |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-[2-(3,4-dimethylphenyl)ethyl]-2,4,6-trimethylpyridin-1-ium |
| SMILES | Cc1cc(C)[n+](CCc2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C18H24N/c1-13-10-16(4)19(17(5)11-13)9-8-18-7-6-14(2)15(3)12-18/h6-7,10-12H,8-9H2,1-5H3/q+1 |
| InChIKey | OUAATRCLSGNEHQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|