C21H20N5S+ — CID 59838417
2-[(3,7-dimethylpurin-3-ium-6-yl)methylidene]-1-ethylbenzo[e][1,3]benzothiazole (PubChem CID 59838417) has the molecular formula C21H20N5S+ and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[(3,7-dimethylpurin-3-ium-6-yl)methylidene]-1-ethylbenzo[e][1,3]benzothiazole.
| Compound Name | 2-[(3,7-dimethylpurin-3-ium-6-yl)methylidene]-1-ethylbenzo[e][1,3]benzothiazole |
|---|---|
| PubChem CID | 59838417 |
| Molecular Formula | C21H20N5S+ |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[(3,7-dimethylpurin-3-ium-6-yl)methylidene]-1-ethylbenzo[e][1,3]benzothiazole |
| SMILES | CCN1C(=Cc2nc[n+](C)c3ncn(C)c23)Sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C21H20N5S/c1-4-26-18(11-16-20-21(23-13-24(20)2)25(3)12-22-16)27-17-10-9-14-7-5-6-8-15(14)19(17)26/h5-13H,4H2,1-3H3/q+1 |
| InChIKey | IEZXAHNXURGZRI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|