About (3-fluoro-2-iodopropyl) acetate
(3-fluoro-2-iodopropyl) acetate (PubChem CID 59838584) has the molecular formula C5H8FIO2
and a molecular weight of 246.02 g/mol. Its IUPAC name is (3-fluoro-2-iodopropyl) acetate.
Molecular Properties
| Compound Name | (3-fluoro-2-iodopropyl) acetate |
| PubChem CID | 59838584 |
| Molecular Formula | C5H8FIO2 |
| Molecular Weight | 246.02 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | (3-fluoro-2-iodopropyl) acetate |
| SMILES | CC(=O)OCC(I)CF |
| InChI | InChI=1S/C5H8FIO2/c1-4(8)9-3-5(7)2-6/h5H,2-3H2,1H3 |
| InChIKey | OXJWBNXYIIANBU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.02 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-fluoro-2-iodopropyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-2-iodopropyl) acetate?
The IUPAC name of (3-fluoro-2-iodopropyl) acetate (CID 59838584) is (3-fluoro-2-iodopropyl) acetate.
What is the SMILES notation for (3-fluoro-2-iodopropyl) acetate?
The canonical SMILES for (3-fluoro-2-iodopropyl) acetate is CC(=O)OCC(I)CF.
What is the InChIKey of (3-fluoro-2-iodopropyl) acetate?
The InChIKey is OXJWBNXYIIANBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FIO2/c1-4(8)9-3-5(7)2-6/h5H,2-3H2,1H3.
What are the key properties of (3-fluoro-2-iodopropyl) acetate?
(3-fluoro-2-iodopropyl) acetate has a molecular weight of 246.02 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-2-iodopropyl) acetate is sourced from PubChem (CID 59838584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).