C17H27NO2 — CID 59838677
2,2,3,3,4,4,5,5,6,6-decadeuterio-1-[1-deuterio-2-[methyl(trideuteriomethyl)amino]-1-(2,3,5,6-tetradeuterio-4-methoxyphenyl)ethyl]cyclohexan-1-ol (PubChem CID 59838677) has the molecular formula C17H27NO2 and a molecular weight of 295.52 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-[1-deuterio-2-[methyl(trideuteriomethyl)amino]-1-(2,3,5,6-tetradeuterio-4-methoxyphenyl)ethyl]cyclohexan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-[1-deuterio-2-[methyl(trideuteriomethyl)amino]-1-(2,3,5,6-tetradeuterio-4-methoxyphenyl)ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 59838677 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 295.52 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-[1-deuterio-2-[methyl(trideuteriomethyl)amino]-1-(2,3,5,6-tetradeuterio-4-methoxyphenyl)ethyl]cyclohexan-1-ol |
| SMILES | [2H]c1c([2H])c(C([2H])(CN(C)C([2H])([2H])[2H])C2(O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C2([2H])[2H])c([2H])c([2H])c1OC |
| InChI | InChI=1S/C17H27NO2/c1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14/h7-10,16,19H,4-6,11-13H2,1-3H3/i1D3,4D2,5D2,6D2,7D,8D,9D,10D,11D2,12D2,16D |
| InChIKey | PNVNVHUZROJLTJ-BQINFYKBSA-N |
| XLogP | 3.04 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |