C35H18F6 — CID 59838838
16,16,18,18-tetrafluoro-3,10-bis(4-fluorophenyl)hexacyclo[13.6.2.02,11.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,10,12,14,19(23),20-decaene (PubChem CID 59838838) has the molecular formula C35H18F6 and a molecular weight of 552.52 g/mol. Its IUPAC name is 16,16,18,18-tetrafluoro-3,10-bis(4-fluorophenyl)hexacyclo[13.6.2.02,11.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,10,12,14,19(23),20-decaene.
| Compound Name | 16,16,18,18-tetrafluoro-3,10-bis(4-fluorophenyl)hexacyclo[13.6.2.02,11.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,10,12,14,19(23),20-decaene |
|---|---|
| PubChem CID | 59838838 |
| Molecular Formula | C35H18F6 |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 16,16,18,18-tetrafluoro-3,10-bis(4-fluorophenyl)hexacyclo[13.6.2.02,11.04,9.012,22.019,23]tricosa-1(22),2,4,6,8,10,12,14,19(23),20-decaene |
| SMILES | Fc1ccc(-c2c3c(c(-c4ccc(F)cc4)c4ccccc24)-c2ccc4c5c(ccc-3c25)C(F)(F)CC4(F)F)cc1 |
| InChI | InChI=1S/C35H18F6/c36-20-9-5-18(6-10-20)28-22-3-1-2-4-23(22)29(19-7-11-21(37)12-8-19)32-25-14-16-27-33-26(34(38,39)17-35(27,40)41)15-13-24(30(25)33)31(28)32/h1-16H,17H2 |
| InChIKey | PYXKNJAZZOEIEF-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |