C22H28F2O4S — CID 59839287
[3-(2,4,6-trimethylphenyl)-1-adamantyl]methyl 2,2-difluoro-2-hydroperoxysulfanylacetate (PubChem CID 59839287) has the molecular formula C22H28F2O4S and a molecular weight of 426.53 g/mol. Its IUPAC name is [3-(2,4,6-trimethylphenyl)-1-adamantyl]methyl 2,2-difluoro-2-hydroperoxysulfanylacetate.
| Compound Name | [3-(2,4,6-trimethylphenyl)-1-adamantyl]methyl 2,2-difluoro-2-hydroperoxysulfanylacetate |
|---|---|
| PubChem CID | 59839287 |
| Molecular Formula | C22H28F2O4S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [3-(2,4,6-trimethylphenyl)-1-adamantyl]methyl 2,2-difluoro-2-hydroperoxysulfanylacetate |
| SMILES | Cc1cc(C)c(C23CC4CC(CC(COC(=O)C(F)(F)SOO)(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C22H28F2O4S/c1-13-4-14(2)18(15(3)5-13)21-9-16-6-17(10-21)8-20(7-16,11-21)12-27-19(25)22(23,24)29-28-26/h4-5,16-17,26H,6-12H2,1-3H3 |
| InChIKey | OXXMDEQEAPCQHT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|