C24H24N2O — CID 59839469
3-N,3-N,6-N,6-N-tetramethyl-9-(6-methylidenecyclohexa-2,4-dien-1-ylidene)xanthene-3,6-diamine (PubChem CID 59839469) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N-tetramethyl-9-(6-methylidenecyclohexa-2,4-dien-1-ylidene)xanthene-3,6-diamine.
| Compound Name | 3-N,3-N,6-N,6-N-tetramethyl-9-(6-methylidenecyclohexa-2,4-dien-1-ylidene)xanthene-3,6-diamine |
|---|---|
| PubChem CID | 59839469 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3-N,3-N,6-N,6-N-tetramethyl-9-(6-methylidenecyclohexa-2,4-dien-1-ylidene)xanthene-3,6-diamine |
| SMILES | C=c1ccccc1=C1c2ccc(N(C)C)cc2Oc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C24H24N2O/c1-16-8-6-7-9-19(16)24-20-12-10-17(25(2)3)14-22(20)27-23-15-18(26(4)5)11-13-21(23)24/h6-15H,1H2,2-5H3 |
| InChIKey | FSYWKUZCEMFUGX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|