C27H38N6 — CID 59839524
2-N,2-N-dibutyl-4-N,6-N-dimethyl-4-N,6-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 59839524) has the molecular formula C27H38N6 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-N,2-N-dibutyl-4-N,6-N-dimethyl-4-N,6-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dibutyl-4-N,6-N-dimethyl-4-N,6-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59839524 |
| Molecular Formula | C27H38N6 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 2-N,2-N-dibutyl-4-N,6-N-dimethyl-4-N,6-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(CCCC)c1nc(N(C)c2ccc(C)cc2)nc(N(C)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C27H38N6/c1-7-9-19-33(20-10-8-2)27-29-25(31(5)23-15-11-21(3)12-16-23)28-26(30-27)32(6)24-17-13-22(4)14-18-24/h11-18H,7-10,19-20H2,1-6H3 |
| InChIKey | PRPQJRACCYNYGJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |