C40H46N4O5 — CID 59839937
benzyl (8S,11S,14S)-5-methyl-14-(methylamino)-11-[3-(methylamino)propyl]-10,13-dioxo-17-phenylmethoxy-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylate (PubChem CID 59839937) has the molecular formula C40H46N4O5 and a molecular weight of 662.83 g/mol. Its IUPAC name is benzyl (8S,11S,14S)-5-methyl-14-(methylamino)-11-[3-(methylamino)propyl]-10,13-dioxo-17-phenylmethoxy-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylate.
| Compound Name | benzyl (8S,11S,14S)-5-methyl-14-(methylamino)-11-[3-(methylamino)propyl]-10,13-dioxo-17-phenylmethoxy-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 59839937 |
| Molecular Formula | C40H46N4O5 |
| Molecular Weight | 662.83 g/mol |
| Exact Mass | 662.35 |
| IUPAC Name | benzyl (8S,11S,14S)-5-methyl-14-(methylamino)-11-[3-(methylamino)propyl]-10,13-dioxo-17-phenylmethoxy-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylate |
| SMILES | CNCCC[C@@H]1NC(=O)[C@@H](NC)Cc2cc(ccc2OCc2ccccc2)-c2ccc(C)c(c2)C[C@@H](C(=O)OCc2ccccc2)NC1=O |
| InChI | InChI=1S/C40H46N4O5/c1-27-16-17-30-21-32(27)23-36(40(47)49-26-29-13-8-5-9-14-29)44-38(45)34(15-10-20-41-2)43-39(46)35(42-3)24-33-22-31(30)18-19-37(33)48-25-28-11-6-4-7-12-28/h4-9,11-14,16-19,21-22,34-36,41-42H,10,15,20,23-26H2,1-3H3,(H,43,46)(H,44,45)/t34-,35-,36-/m0/s1 |
| InChIKey | IAFOFHMFXQGRQW-KVBYWJEESA-N |
| XLogP | 4.64 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|