C26H37N5O2 — CID 59840269
N,N-diethyl-1-[4-[(4-pyridin-3-ylphenyl)carbamoylamino]butyl]piperidine-3-carboxamide (PubChem CID 59840269) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is N,N-diethyl-1-[4-[(4-pyridin-3-ylphenyl)carbamoylamino]butyl]piperidine-3-carboxamide.
| Compound Name | N,N-diethyl-1-[4-[(4-pyridin-3-ylphenyl)carbamoylamino]butyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 59840269 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | N,N-diethyl-1-[4-[(4-pyridin-3-ylphenyl)carbamoylamino]butyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(CCCCNC(=O)Nc2ccc(-c3cccnc3)cc2)C1 |
| InChI | InChI=1S/C26H37N5O2/c1-3-31(4-2)25(32)23-10-8-18-30(20-23)17-6-5-16-28-26(33)29-24-13-11-21(12-14-24)22-9-7-15-27-19-22/h7,9,11-15,19,23H,3-6,8,10,16-18,20H2,1-2H3,(H2,28,29,33) |
| InChIKey | VSIXRQIUDLOQHA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|